Molecular Definition

Canonical SMILES CC(=O)N1CCC(CC1)n2cc(cn2)c3cnc(N)c4oc(cc34)c5cccc6ncsc56
Formula C24H22N6O2S
Molecular Weight 458.54 da
Stereocenters 0/0