Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1cc(C#N)c(nc1C(F)(F)F)N2CCN(C(CCC(=O)O)C2)C(=O)NS(=O)(=O)c3ccc(Cl)s3
Formula C22H21ClF3N5O7S2
Molecular Weight 624.01 da
Stereocenters 0/1