Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C1=CC(=O)c2cc(Br)cc(NC(=O)c3ccc(Cl)cc3Cl)c2O1
Formula C17H8BrCl2NO5
Molecular Weight 457.06 da
Stereocenters 0/0