Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C1=CC(=O)c2cc(Br)cc(NC(=O)c3ccccc3)c2O1
Formula C17H10BrNO5
Molecular Weight 388.17 da
Stereocenters 0/0