Molecular Definition

Canonical SMILES NS(=O)(=O)c1ccc(NC(=S)NCc2cccnc2)cc1
Formula C13H14N4O2S2
Molecular Weight 322.41 da
Stereocenters 0/0