Molecular Definition

Canonical SMILES COc1ccc(cc1)C2=NNC3(S2)C(=O)N(Cc4ccccc4)c5ccccc35
Formula C23H19N3O2S
Molecular Weight 401.48 da
Stereocenters 0/1