Molecular Definition

Canonical SMILES Cl.CCc1cc2[C@H]3CNC[C@@H]3NC(=O)c2c(c1)C(F)(F)F
Formula C14H16ClF3N2O
Molecular Weight 320.74 da
Stereocenters 2/2