Molecular Definition

Canonical SMILES COC[C@@H]1CCCN1Cc2ccc(cc2)C(=O)N(CCc3ccccc3OC)C4CCNC4
Formula C27H37N3O3
Molecular Weight 451.60 da
Stereocenters 1/2