Molecular Definition

Canonical SMILES CSC(=S)N1CC2(CCCCC2)CS/C/1=N\c3cccc(c3)C(C)C
Formula C20H28N2S3
Molecular Weight 392.65 da
Stereocenters 0/0