Molecular Definition

Canonical SMILES O[C@@]1(CC[C@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F)c5nccs5
Formula C23H25F3N6O2S
Molecular Weight 506.54 da
Stereocenters 2/2