Molecular Definition

Canonical SMILES NC(=O)c1ccc2[nH]cc(C3=CCC(CC3)NCCCCCCCNC4CCC(=CC4)c5c[nH]c6ccc(cc56)C(=O)N)c2c1
Formula C37H46N6O2
Molecular Weight 606.80 da
Stereocenters 0/2