Molecular Definition

Canonical SMILES COc1ccc(NC(=O)c2ccc(cc2)c3ccc(cc3C)c4noc(C)n4)cc1CCCN(C)C
Formula C29H32N4O3
Molecular Weight 484.59 da
Stereocenters 0/0