Molecular Definition

Canonical SMILES CSc1ccc(NC(=O)C(C)NC2=Nc3c(cnn3c4ccccc4Cl)C(=O)N2)cc1
Formula C21H19ClN6O2S
Molecular Weight 454.93 da
Stereocenters 0/1