Molecular Definition

Canonical SMILES COc1cccc(NC(=O)C(C)NC2=Nc3c(cnn3c4ccccc4Cl)C(=O)N2)c1
Formula C21H19ClN6O3
Molecular Weight 438.87 da
Stereocenters 0/1