Molecular Definition

Canonical SMILES COc1ccccc1OC2CCN(C2)[C@H](C)C3=Nc4c(cnn4C5CCCC5)C(=O)N3
Formula C23H29N5O3
Molecular Weight 423.51 da
Stereocenters 1/2