Molecular Definition

Canonical SMILES C[C@@H](N1CCC(C1)c2ccccc2)C3=Nc4c(cnn4C5CCCC5)C(=O)N3
Formula C22H27N5O
Molecular Weight 377.48 da
Stereocenters 1/2