Molecular Definition

Canonical SMILES Nc1ncnc2scc(c3ccc(NC(=O)Cc4cc(F)ccc4F)cc3)c12
Formula C20H14F2N4OS
Molecular Weight 396.41 da
Stereocenters 0/0