Molecular Definition

Canonical SMILES Cc1ccccc1N2N=C(C=CC2=O)c3c4NC[C@@H](CO)Cn4nc3c5ccc(F)cc5
Formula C24H22FN5O2
Molecular Weight 431.46 da
Stereocenters 1/1