Molecular Definition

Canonical SMILES CC(C)(C)C(=O)NCC(=O)N1CCC[C@H]1B(O)O
Formula C11H21BN2O4
Molecular Weight 256.11 da
Stereocenters 1/1