Target Relevance

Molecular Definition

Canonical SMILES Cc1[nH]cnc1C2CCN(CC2)c3ncnc(Cl)c3c4ccccc4
Formula C19H20ClN5
Molecular Weight 353.85 da
Stereocenters 0/0