Molecular Definition

Canonical SMILES O[C@@H]1C[C@H](N(C1)C(=O)CC(c2ccc(Cl)cc2)(c3ccc(Cl)cc3)c4ccc(Cl)cc4)C(=O)N5CCC[C@@H]5C(=O)NC[C@@H]6CCCNC6
Formula C37H41Cl3N4O4
Molecular Weight 712.11 da
Stereocenters 4/4