Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)\N=C(/NCC(=O)N)\N2CC(C(=N2)c3ccc(Cl)cc3)c4ccccc4
Formula C25H24ClN5O4S
Molecular Weight 526.01 da
Stereocenters 0/1