Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1ccc(cc1)S(=O)(=O)\N=C(/NC)\N2CC(C(=N2)c3ccc(Cl)cc3)c4ccccc4
Formula C26H25ClN4O4S
Molecular Weight 525.02 da
Stereocenters 0/1