Molecular Definition

Canonical SMILES O=C1OCc2cc(CCN3CCN(CCc4ccc5nonc5c4)CC3)ccc12
Formula C22H24N4O3
Molecular Weight 392.45 da
Stereocenters 0/0