Molecular Definition

Canonical SMILES C(Cc1ccc2nonc2c1)N3CCN(CCc4ccc5nonc5c4)CC3
Formula C20H22N6O2
Molecular Weight 378.43 da
Stereocenters 0/0