Molecular Definition

Canonical SMILES N#Cc1ccc(CCN2CCN(CCc3ccc4nonc4c3)CC2)cc1
Formula C21H23N5O
Molecular Weight 361.44 da
Stereocenters 0/0