Target Relevance

Molecular Definition

Canonical SMILES CCOc1ncnc(N2CCC(CC2)c3[nH]cnc3C)c1c4ccccc4
Formula C21H25N5O
Molecular Weight 363.46 da
Stereocenters 0/0