Molecular Definition

Canonical SMILES CC1=C(C(NC(=O)N1)c2ccc(cc2)[N+](=O)[O-])C(=O)OC3CCCC3
Formula C17H19N3O5
Molecular Weight 345.35 da
Stereocenters 0/1