Molecular Definition

Canonical SMILES Cl.O=C(N[C@@H]1CC[C@@H](CCN2CCc3ccc(cc3C2)C#N)CC1)\C=C\c4ccccc4
Formula C27H32ClN3O
Molecular Weight 450.02 da
Stereocenters 2/2