Molecular Definition

Canonical SMILES Cl.O=C(N[C@@H]1CC[C@@H](CCN2CCc3cc(ccc3C2)C#N)CC1)c4ccc5ccccc5c4
Formula C29H32ClN3O
Molecular Weight 474.04 da
Stereocenters 2/2