Target Relevance

Molecular Definition

Canonical SMILES CCC[C@H](NC(=O)C1(CCCCC1)NC(=O)c2ccc(cc2)N(C)C)C(=O)c3oc(nn3)c4occc4
Formula C27H33N5O5
Molecular Weight 507.58 da
Stereocenters 1/1