Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2nc(NCc3cccc(F)c3F)sc2c4ccc5ncnn5c4
Formula C22H16F2N6S
Molecular Weight 434.46 da
Stereocenters 0/0