Molecular Definition

Canonical SMILES CN(C)C(C)(C)c1nnc2c(F)c(c(F)cn12)c3cc(cc(F)c3C)C(=O)NC4CC4
Formula C22H24F3N5O
Molecular Weight 431.45 da
Stereocenters 0/0