Molecular Definition

Canonical SMILES CC(C)c1nnc2c(F)c(c(F)cn12)c3cc(cc(F)c3C)C(=O)NC4CC4
Formula C20H19F3N4O
Molecular Weight 388.39 da
Stereocenters 0/0