Molecular Definition

Canonical SMILES Cc1c(F)cc(cc1c2ccn3c(nnc3c2)C(C)(C)NS(=O)(=O)C)C(=O)NC4CC4
Formula C21H24FN5O3S
Molecular Weight 445.51 da
Stereocenters 0/0