Molecular Definition

Canonical SMILES Cc1c(F)cc(cc1c2ccn3c(nnc3c2)C(C)(C)N)C(=O)NC4CC4
Formula C20H22FN5O
Molecular Weight 367.42 da
Stereocenters 0/0