Molecular Definition

Canonical SMILES COC(C)c1nnc2cc(ccn12)c3cc(cc(F)c3C)C(=O)NC4CC4
Formula C20H21FN4O2
Molecular Weight 368.40 da
Stereocenters 0/1