Molecular Definition

Canonical SMILES Cc1c(F)cc(cc1c2ccn3c(nnc3c2)C4CC4)C(=O)NC5CC5
Formula C20H19FN4O
Molecular Weight 350.39 da
Stereocenters 0/0