Molecular Definition

Canonical SMILES Cc1ccc(cc1c2ccn3c(nnc3c2)C(C)(C)C)C(=O)NC4CC4
Formula C21H24N4O
Molecular Weight 348.44 da
Stereocenters 0/0