Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)c2ccc(NC(=O)C=C)cc2Cl
Formula C18H24ClN3O5S
Molecular Weight 429.92 da
Stereocenters 0/0