Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)C3COCCN3S(=O)(=O)c4ccc(C)cc4)n2
Formula C22H23N3O5S2
Molecular Weight 473.57 da
Stereocenters 0/1