Molecular Definition

Canonical SMILES Nc1ccc(cc1NC(=O)c2ccc(CNC(=O)OCc3cc(CN=[N+]=[N-])cc(c3)N=[N+]=[N-])cc2)c4ccccc4
Formula C29H25N9O3
Molecular Weight 547.57 da
Stereocenters 0/0