Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H](N[C@@H](c1ccc(cc1)c2ccc(F)c(F)c2)C(F)(F)F)C(=O)NCC#N
Formula C22H22F5N3O
Molecular Weight 439.42 da
Stereocenters 2/2