Molecular Definition

Canonical SMILES CCCC[C@H](NC(=O)O[C@@H](C)Cc1ccccc1)\C=N\NC(=O)N2CCOCC2
Formula C21H32N4O4
Molecular Weight 404.50 da
Stereocenters 2/2