Molecular Definition

Canonical SMILES OC(=O)C1CN(Cc2ccc(cc2)c3noc(n3)c4ccc(cc4)C5CCCCC5)C1
Formula C25H27N3O3
Molecular Weight 417.50 da
Stereocenters 0/0