Molecular Definition

Canonical SMILES CCCC[C@H](NC(=O)OC1CC2CCC1C2)C(=O)C(=O)N[C@H](C)c3ccccc3
Formula C23H32N2O4
Molecular Weight 400.51 da
Stereocenters 2/5