Molecular Definition

Canonical SMILES ONC(=O)[C@@H]1CSCN1S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2
Formula C16H15ClN2O5S2
Molecular Weight 414.88 da
Stereocenters 1/1