Molecular Definition

Canonical SMILES CN1C(=O)N(Cc2nc(C)c3ccccc3n2)C(=O)c4c1c(C#N)c(N5CCC[C@H](N)C5)n4CC=C(C)C
Formula C28H32N8O2
Molecular Weight 512.61 da
Stereocenters 1/1