Target Relevance

Molecular Definition

Canonical SMILES CCNC(=O)[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)nc(NCCc4ccc(CCC(=O)N[C@@H](CCCNC(=N)N)C(=O)O)cc4)nc23
Formula C29H41N11O7
Molecular Weight 655.71 da
Stereocenters 5/5