Molecular Definition

Canonical SMILES Cc1cccc2c(CCNCc3ccc(CCNC[C@H](O)c4ccc(O)c5NC(=O)Sc45)cc3)c[nH]c12
Formula C29H32N4O3S
Molecular Weight 516.65 da
Stereocenters 1/1